C18H15N3O5 — CID 28935072
(2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)propanamide (PubChem CID 28935072) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)propanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)propanamide |
|---|---|
| PubChem CID | 28935072 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc2c(c1)OCCO2)N1C(=O)c2ccncc2C1=O |
| InChI | InChI=1S/C18H15N3O5/c1-10(21-17(23)12-4-5-19-9-13(12)18(21)24)16(22)20-11-2-3-14-15(8-11)26-7-6-25-14/h2-5,8-10H,6-7H2,1H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | ITVVNFAOZACAKE-JTQLQIEISA-N |
| XLogP | 1.48 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|