C14H18N2O3S — CID 28941465
1-(3,4-dimethylphenyl)sulfonyl-4-isocyanatopiperidine (PubChem CID 28941465) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-isocyanatopiperidine.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-isocyanatopiperidine |
|---|---|
| PubChem CID | 28941465 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-isocyanatopiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N=C=O)CC2)cc1C |
| InChI | InChI=1S/C14H18N2O3S/c1-11-3-4-14(9-12(11)2)20(18,19)16-7-5-13(6-8-16)15-10-17/h3-4,9,13H,5-8H2,1-2H3 |
| InChIKey | VVWRKFOYQGQRAU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|