C14H21NO2S2 — CID 91813604
1-(3,4-dimethylphenyl)sulfonyl-3-methylsulfanylpiperidine (PubChem CID 91813604) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-3-methylsulfanylpiperidine.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-3-methylsulfanylpiperidine |
|---|---|
| PubChem CID | 91813604 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-3-methylsulfanylpiperidine |
| SMILES | CSC1CCCN(S(=O)(=O)c2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C14H21NO2S2/c1-11-6-7-14(9-12(11)2)19(16,17)15-8-4-5-13(10-15)18-3/h6-7,9,13H,4-5,8,10H2,1-3H3 |
| InChIKey | NTMIYGHLGCXRQG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |