C12H13Br3N2O — CID 28992192
(3S)-N-(2,4,6-tribromophenyl)piperidine-3-carboxamide (PubChem CID 28992192) has the molecular formula C12H13Br3N2O and a molecular weight of 440.96 g/mol. Its IUPAC name is (3S)-N-(2,4,6-tribromophenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,4,6-tribromophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28992192 |
| Molecular Formula | C12H13Br3N2O |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 437.86 |
| IUPAC Name | (3S)-N-(2,4,6-tribromophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)[C@H]1CCCNC1 |
| InChI | InChI=1S/C12H13Br3N2O/c13-8-4-9(14)11(10(15)5-8)17-12(18)7-2-1-3-16-6-7/h4-5,7,16H,1-3,6H2,(H,17,18)/t7-/m0/s1 |
| InChIKey | YYHCCDVOZCOPDU-ZETCQYMHSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |