About 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid
3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 63788349) has the molecular formula C14H14Br3NO3
and a molecular weight of 483.98 g/mol. Its IUPAC name is 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 63788349 |
| Molecular Formula | C14H14Br3NO3 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 480.85 |
| IUPAC Name | 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)Nc2c(Br)cc(Br)cc2Br)C1 |
| InChI | InChI=1S/C14H14Br3NO3/c15-9-5-10(16)12(11(17)6-9)18-13(19)7-2-1-3-8(4-7)14(20)21/h5-8H,1-4H2,(H,18,19)(H,20,21) |
| InChIKey | WKTGNOASXALFQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CID 63788349) is 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCCC(C(=O)Nc2c(Br)cc(Br)cc2Br)C1.
What is the InChIKey of 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is WKTGNOASXALFQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Br3NO3/c15-9-5-10(16)12(11(17)6-9)18-13(19)7-2-1-3-8(4-7)14(20)21/h5-8H,1-4H2,(H,18,19)(H,20,21).
What are the key properties of 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 483.98 g/mol, XLogP of 4.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4,6-tribromophenyl)carbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 63788349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).