C28H35N3O3 — CID 29020476
(2R)-1-[(Z)-[1-benzofuran-2-yl-(3-methyl-3-phenylcyclobutyl)methylidene]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 29020476) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is (2R)-1-[(Z)-[1-benzofuran-2-yl-(3-methyl-3-phenylcyclobutyl)methylidene]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[(Z)-[1-benzofuran-2-yl-(3-methyl-3-phenylcyclobutyl)methylidene]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 29020476 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | (2R)-1-[(Z)-[1-benzofuran-2-yl-(3-methyl-3-phenylcyclobutyl)methylidene]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | CN1CCN(C[C@@H](O)CO/N=C(\c2cc3ccccc3o2)C2CC(C)(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-28(23-9-4-3-5-10-23)17-22(18-28)27(26-16-21-8-6-7-11-25(21)34-26)29-33-20-24(32)19-31-14-12-30(2)13-15-31/h3-11,16,22,24,32H,12-15,17-20H2,1-2H3/b29-27-/t22?,24-,28?/m1/s1 |
| InChIKey | HPIJBBGTQSUOMB-COEDMGAMSA-N |
| XLogP | 4.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|