C16H19ClFN3O3 — CID 45271573
(2Z)-N-[3-(4-fluoropiperidin-1-yl)-2-hydroxypropoxy]-1,3-benzoxazole-2-carboximidoyl chloride (PubChem CID 45271573) has the molecular formula C16H19ClFN3O3 and a molecular weight of 355.80 g/mol. Its IUPAC name is (2Z)-N-[3-(4-fluoropiperidin-1-yl)-2-hydroxypropoxy]-1,3-benzoxazole-2-carboximidoyl chloride.
| Compound Name | (2Z)-N-[3-(4-fluoropiperidin-1-yl)-2-hydroxypropoxy]-1,3-benzoxazole-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 45271573 |
| Molecular Formula | C16H19ClFN3O3 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2Z)-N-[3-(4-fluoropiperidin-1-yl)-2-hydroxypropoxy]-1,3-benzoxazole-2-carboximidoyl chloride |
| SMILES | OC(CO/N=C(\Cl)c1nc2ccccc2o1)CN1CCC(F)CC1 |
| InChI | InChI=1S/C16H19ClFN3O3/c17-15(16-19-13-3-1-2-4-14(13)24-16)20-23-10-12(22)9-21-7-5-11(18)6-8-21/h1-4,11-12,22H,5-10H2/b20-15- |
| InChIKey | IJFZFLBSNJLVKK-HKWRFOASSA-N |
| XLogP | 2.54 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|