C30H39N3O5 — CID 2903787
[4-(2,3-dimethylphenyl)piperazin-1-yl]-[1-(2-methyl-3-phenylprop-2-enyl)piperidin-4-yl]methanone;oxalic acid (PubChem CID 2903787) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)piperazin-1-yl]-[1-(2-methyl-3-phenylprop-2-enyl)piperidin-4-yl]methanone;oxalic acid.
| Compound Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-[1-(2-methyl-3-phenylprop-2-enyl)piperidin-4-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 2903787 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-[1-(2-methyl-3-phenylprop-2-enyl)piperidin-4-yl]methanone;oxalic acid |
| SMILES | CC(=Cc1ccccc1)CN1CCC(C(=O)N2CCN(c3cccc(C)c3C)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C28H37N3O.C2H2O4/c1-22(20-25-9-5-4-6-10-25)21-29-14-12-26(13-15-29)28(32)31-18-16-30(17-19-31)27-11-7-8-23(2)24(27)3;3-1(4)2(5)6/h4-11,20,26H,12-19,21H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PDDXEFRIUXTYMW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|