C19H24N2O4 — CID 29056290
3-nitro-4-[[(1S,2R,3R)-2,3,5,5-tetramethylcyclohexyl]amino]chromen-2-one (PubChem CID 29056290) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-nitro-4-[[(1S,2R,3R)-2,3,5,5-tetramethylcyclohexyl]amino]chromen-2-one.
| Compound Name | 3-nitro-4-[[(1S,2R,3R)-2,3,5,5-tetramethylcyclohexyl]amino]chromen-2-one |
|---|---|
| PubChem CID | 29056290 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-nitro-4-[[(1S,2R,3R)-2,3,5,5-tetramethylcyclohexyl]amino]chromen-2-one |
| SMILES | C[C@@H]1[C@H](C)CC(C)(C)C[C@@H]1Nc1c([N+](=O)[O-])c(=O)oc2ccccc12 |
| InChI | InChI=1S/C19H24N2O4/c1-11-9-19(3,4)10-14(12(11)2)20-16-13-7-5-6-8-15(13)25-18(22)17(16)21(23)24/h5-8,11-12,14,20H,9-10H2,1-4H3/t11-,12-,14+/m1/s1 |
| InChIKey | WZCPBHQNGPQOEP-BZPMIXESSA-N |
| XLogP | 4.57 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|