C24H25BrN2O2 — CID 29057172
(2R)-2-(1-bromonaphthalen-2-yl)oxy-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]butanamide (PubChem CID 29057172) has the molecular formula C24H25BrN2O2 and a molecular weight of 453.38 g/mol. Its IUPAC name is (2R)-2-(1-bromonaphthalen-2-yl)oxy-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]butanamide.
| Compound Name | (2R)-2-(1-bromonaphthalen-2-yl)oxy-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 29057172 |
| Molecular Formula | C24H25BrN2O2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (2R)-2-(1-bromonaphthalen-2-yl)oxy-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]butanamide |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1Br)C(=O)N/N=C\c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H25BrN2O2/c1-5-21(29-22-11-10-18-8-6-7-9-19(18)23(22)25)24(28)27-26-14-20-16(3)12-15(2)13-17(20)4/h6-14,21H,5H2,1-4H3,(H,27,28)/b26-14-/t21-/m1/s1 |
| InChIKey | OINCUUNHNWFIIU-WZRHPCBOSA-N |
| XLogP | 5.84 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|