C21H17Br2N3O5 — CID 135620078
N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(1-bromonaphthalen-2-yl)oxybutanamide (PubChem CID 135620078) has the molecular formula C21H17Br2N3O5 and a molecular weight of 551.19 g/mol. Its IUPAC name is N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(1-bromonaphthalen-2-yl)oxybutanamide.
| Compound Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(1-bromonaphthalen-2-yl)oxybutanamide |
|---|---|
| PubChem CID | 135620078 |
| Molecular Formula | C21H17Br2N3O5 |
| Molecular Weight | 551.19 g/mol |
| Exact Mass | 548.95 |
| IUPAC Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(1-bromonaphthalen-2-yl)oxybutanamide |
| SMILES | CCC(Oc1ccc2ccccc2c1Br)C(=O)N/N=C/c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C21H17Br2N3O5/c1-2-17(31-18-8-7-12-5-3-4-6-15(12)19(18)23)21(28)25-24-11-13-9-14(26(29)30)10-16(22)20(13)27/h3-11,17,27H,2H2,1H3,(H,25,28)/b24-11+ |
| InChIKey | SXEANQOPCPJIQK-BHGWPJFGSA-N |
| XLogP | 5.29 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|