C21H24N4O3S3 — CID 2906586
4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 2906586) has the molecular formula C21H24N4O3S3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 2906586 |
| Molecular Formula | C21H24N4O3S3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | COc1cccc(C=C2SC(=S)N(CCCC(=O)Nc3nnc(CC(C)C)s3)C2=O)c1 |
| InChI | InChI=1S/C21H24N4O3S3/c1-13(2)10-18-23-24-20(31-18)22-17(26)8-5-9-25-19(27)16(30-21(25)29)12-14-6-4-7-15(11-14)28-3/h4,6-7,11-13H,5,8-10H2,1-3H3,(H,22,24,26) |
| InChIKey | QHJRZLKUTVTDBS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|