C18H20N4O3S3 — CID 6204339
4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 6204339) has the molecular formula C18H20N4O3S3 and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 6204339 |
| Molecular Formula | C18H20N4O3S3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC(C)Cc1nnc(NC(=O)CCCN2C(=O)/C(=C\c3ccco3)SC2=S)s1 |
| InChI | InChI=1S/C18H20N4O3S3/c1-11(2)9-15-20-21-17(28-15)19-14(23)6-3-7-22-16(24)13(27-18(22)26)10-12-5-4-8-25-12/h4-5,8,10-11H,3,6-7,9H2,1-2H3,(H,19,21,23)/b13-10+ |
| InChIKey | JQBORENCBDBIGM-JLHYYAGUSA-N |
| XLogP | 3.95 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|