C19H20ClN3O6S — CID 2907806
2-chloro-5-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-nitrophenyl)benzamide (PubChem CID 2907806) has the molecular formula C19H20ClN3O6S and a molecular weight of 453.90 g/mol. Its IUPAC name is 2-chloro-5-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-nitrophenyl)benzamide.
| Compound Name | 2-chloro-5-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 2907806 |
| Molecular Formula | C19H20ClN3O6S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-chloro-5-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(2-nitrophenyl)benzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Cl)c(C(=O)Nc3ccccc3[N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C19H20ClN3O6S/c1-12-10-22(11-13(2)29-12)30(27,28)14-7-8-16(20)15(9-14)19(24)21-17-5-3-4-6-18(17)23(25)26/h3-9,12-13H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | MKGZZZMJXBMWSR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|