About 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid
1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid (PubChem CID 29082324) has the molecular formula C13H15N3O4S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid |
| PubChem CID | 29082324 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid |
| SMILES | Cc1ccc(C)c(S(=O)(=O)CCn2cc(C(=O)O)nn2)c1 |
| InChI | InChI=1S/C13H15N3O4S/c1-9-3-4-10(2)12(7-9)21(19,20)6-5-16-8-11(13(17)18)14-15-16/h3-4,7-8H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | XVFFHPLYGCKMMO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid (CID 29082324) is 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid is Cc1ccc(C)c(S(=O)(=O)CCn2cc(C(=O)O)nn2)c1.
What is the InChIKey of 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid?
The InChIKey is XVFFHPLYGCKMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O4S/c1-9-3-4-10(2)12(7-9)21(19,20)6-5-16-8-11(13(17)18)14-15-16/h3-4,7-8H,5-6H2,1-2H3,(H,17,18).
What are the key properties of 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid?
1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid has a molecular weight of 309.35 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,5-dimethylphenyl)sulfonylethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 29082324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).