C22H15F2N3O4S — CID 29090102
7-(1,3-benzodioxol-5-yl)-5-(difluoromethyl)-1-(2-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090102) has the molecular formula C22H15F2N3O4S and a molecular weight of 455.44 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-5-(difluoromethyl)-1-(2-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-5-(difluoromethyl)-1-(2-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090102 |
| Molecular Formula | C22H15F2N3O4S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-5-(difluoromethyl)-1-(2-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1-n1c(=S)[nH]c(=O)c2c(C(F)F)cc(-c3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C22H15F2N3O4S/c1-29-15-5-3-2-4-14(15)27-20-18(21(28)26-22(27)32)12(19(23)24)9-13(25-20)11-6-7-16-17(8-11)31-10-30-16/h2-9,19H,10H2,1H3,(H,26,28,32) |
| InChIKey | MQJVXQLIKMXVLQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|