C17H18F3N5O2S — CID 29091316
7-(1-ethylpyrazol-4-yl)-1-(3-methoxypropyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 29091316) has the molecular formula C17H18F3N5O2S and a molecular weight of 413.43 g/mol. Its IUPAC name is 7-(1-ethylpyrazol-4-yl)-1-(3-methoxypropyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(1-ethylpyrazol-4-yl)-1-(3-methoxypropyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29091316 |
| Molecular Formula | C17H18F3N5O2S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 7-(1-ethylpyrazol-4-yl)-1-(3-methoxypropyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCn1cc(-c2cc(C(F)(F)F)c3c(=O)[nH]c(=S)n(CCCOC)c3n2)cn1 |
| InChI | InChI=1S/C17H18F3N5O2S/c1-3-24-9-10(8-21-24)12-7-11(17(18,19)20)13-14(22-12)25(5-4-6-27-2)16(28)23-15(13)26/h7-9H,3-6H2,1-2H3,(H,23,26,28) |
| InChIKey | CMQZXXQRNSGBHW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|