C20H27N5O2S — CID 29096121
1-ethyl-N-[(2-ethylpyrazol-3-yl)methyl]-3-methyl-N-(2-phenylethyl)pyrazole-4-sulfonamide (PubChem CID 29096121) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 1-ethyl-N-[(2-ethylpyrazol-3-yl)methyl]-3-methyl-N-(2-phenylethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[(2-ethylpyrazol-3-yl)methyl]-3-methyl-N-(2-phenylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 29096121 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-ethyl-N-[(2-ethylpyrazol-3-yl)methyl]-3-methyl-N-(2-phenylethyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(CCc2ccccc2)Cc2ccnn2CC)c(C)n1 |
| InChI | InChI=1S/C20H27N5O2S/c1-4-23-16-20(17(3)22-23)28(26,27)24(14-12-18-9-7-6-8-10-18)15-19-11-13-21-25(19)5-2/h6-11,13,16H,4-5,12,14-15H2,1-3H3 |
| InChIKey | JXJRISYTEDEGGU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |