C21H24BrN3O2S — CID 29089808
4-bromo-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 29089808) has the molecular formula C21H24BrN3O2S and a molecular weight of 462.41 g/mol. Its IUPAC name is 4-bromo-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 29089808 |
| Molecular Formula | C21H24BrN3O2S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 4-bromo-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CCn1ncc(CN(CCc2ccccc2)S(=O)(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C21H24BrN3O2S/c1-3-25-17(2)19(15-23-25)16-24(14-13-18-7-5-4-6-8-18)28(26,27)21-11-9-20(22)10-12-21/h4-12,15H,3,13-14,16H2,1-2H3 |
| InChIKey | ZSOKCVCLKVRTLX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |