C19H25N5O2S — CID 29090004
1-ethyl-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]-N-(2-phenylethyl)pyrazole-4-sulfonamide (PubChem CID 29090004) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]-N-(2-phenylethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]-N-(2-phenylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 29090004 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-ethyl-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]-N-(2-phenylethyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(CCc2ccccc2)Cc2ccn(C)n2)c(C)n1 |
| InChI | InChI=1S/C19H25N5O2S/c1-4-23-15-19(16(2)20-23)27(25,26)24(14-18-11-12-22(3)21-18)13-10-17-8-6-5-7-9-17/h5-9,11-12,15H,4,10,13-14H2,1-3H3 |
| InChIKey | CFOJWKNFYDBSIH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |