C20H21N5O3 — CID 29096210
1-methyl-5-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid (PubChem CID 29096210) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-methyl-5-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 29096210 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-methyl-5-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cc(N2CCN(C(=O)c3c(C(=O)O)cnn3C)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H21N5O3/c1-13-11-17(22-16-6-4-3-5-14(13)16)24-7-9-25(10-8-24)19(26)18-15(20(27)28)12-21-23(18)2/h3-6,11-12H,7-10H2,1-2H3,(H,27,28) |
| InChIKey | CPINOUJJSXRCJD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |