C18H20N6 — CID 29103169
2-[4-(4-benzyltriazol-1-yl)piperidin-1-yl]pyrazine (PubChem CID 29103169) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-[4-(4-benzyltriazol-1-yl)piperidin-1-yl]pyrazine.
| Compound Name | 2-[4-(4-benzyltriazol-1-yl)piperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 29103169 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[4-(4-benzyltriazol-1-yl)piperidin-1-yl]pyrazine |
| SMILES | c1ccc(Cc2cn(C3CCN(c4cnccn4)CC3)nn2)cc1 |
| InChI | InChI=1S/C18H20N6/c1-2-4-15(5-3-1)12-16-14-24(22-21-16)17-6-10-23(11-7-17)18-13-19-8-9-20-18/h1-5,8-9,13-14,17H,6-7,10-12H2 |
| InChIKey | VBIKMGDIFOZKBK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |