C27H24ClNO5 — CID 2911184
4-[[4-[2-(4-chloro-3-methylphenoxy)ethoxy]-3-ethoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 2911184) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is 4-[[4-[2-(4-chloro-3-methylphenoxy)ethoxy]-3-ethoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[[4-[2-(4-chloro-3-methylphenoxy)ethoxy]-3-ethoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2911184 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 4-[[4-[2-(4-chloro-3-methylphenoxy)ethoxy]-3-ethoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CCOc1cc(C=C2N=C(c3ccccc3)OC2=O)ccc1OCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C27H24ClNO5/c1-3-31-25-17-19(16-23-27(30)34-26(29-23)20-7-5-4-6-8-20)9-12-24(25)33-14-13-32-21-10-11-22(28)18(2)15-21/h4-12,15-17H,3,13-14H2,1-2H3 |
| InChIKey | QUZOCCOVCZGDAB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|