C23H24N2O5 — CID 29126866
8-methoxy-3-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]chromen-2-one (PubChem CID 29126866) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 8-methoxy-3-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]chromen-2-one.
| Compound Name | 8-methoxy-3-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 29126866 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 8-methoxy-3-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]chromen-2-one |
| SMILES | COc1cccc2cc(-c3ccc(OCC(=O)N4CCN(C)CC4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C23H24N2O5/c1-24-10-12-25(13-11-24)21(26)15-29-18-8-6-16(7-9-18)19-14-17-4-3-5-20(28-2)22(17)30-23(19)27/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | DGTYKMNRODHPLM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|