C26H23NO6 — CID 42507195
N-[2-(4-hydroxyphenyl)ethyl]-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide (PubChem CID 42507195) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 42507195 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide |
| SMILES | COc1cccc2cc(-c3ccc(OCC(=O)NCCc4ccc(O)cc4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C26H23NO6/c1-31-23-4-2-3-19-15-22(26(30)33-25(19)23)18-7-11-21(12-8-18)32-16-24(29)27-14-13-17-5-9-20(28)10-6-17/h2-12,15,28H,13-14,16H2,1H3,(H,27,29) |
| InChIKey | FELRFQSPJXFGGX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|