C25H27NO6 — CID 56763657
N-(2,2-dimethyloxan-4-yl)-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide (PubChem CID 56763657) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 56763657 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetamide |
| SMILES | COc1cccc2cc(-c3ccc(OCC(=O)NC4CCOC(C)(C)C4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C25H27NO6/c1-25(2)14-18(11-12-31-25)26-22(27)15-30-19-9-7-16(8-10-19)20-13-17-5-4-6-21(29-3)23(17)32-24(20)28/h4-10,13,18H,11-12,14-15H2,1-3H3,(H,26,27) |
| InChIKey | KVWLMVRJIDCWEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|