C20H26N2O6S — CID 29133288
7-[(2S)-2-hydroxy-3-(4-methylsulfonylpiperazin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 29133288) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-(4-methylsulfonylpiperazin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 7-[(2S)-2-hydroxy-3-(4-methylsulfonylpiperazin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 29133288 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-(4-methylsulfonylpiperazin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | CS(=O)(=O)N1CCN(C[C@H](O)COc2ccc3c4c(c(=O)oc3c2)CCC4)CC1 |
| InChI | InChI=1S/C20H26N2O6S/c1-29(25,26)22-9-7-21(8-10-22)12-14(23)13-27-15-5-6-17-16-3-2-4-18(16)20(24)28-19(17)11-15/h5-6,11,14,23H,2-4,7-10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | KUGQMXMMPGHDEG-AWEZNQCLSA-N |
| XLogP | 0.60 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|