C23H26NO4+ — CID 6991924
benzyl-[(2S)-2-hydroxy-3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]-methylazanium (PubChem CID 6991924) has the molecular formula C23H26NO4+ and a molecular weight of 380.46 g/mol. Its IUPAC name is benzyl-[(2S)-2-hydroxy-3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]-methylazanium.
| Compound Name | benzyl-[(2S)-2-hydroxy-3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]-methylazanium |
|---|---|
| PubChem CID | 6991924 |
| Molecular Formula | C23H26NO4+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | benzyl-[(2S)-2-hydroxy-3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]-methylazanium |
| SMILES | C[NH+](Cc1ccccc1)C[C@H](O)COc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C23H25NO4/c1-24(13-16-6-3-2-4-7-16)14-17(25)15-27-18-10-11-20-19-8-5-9-21(19)23(26)28-22(20)12-18/h2-4,6-7,10-12,17,25H,5,8-9,13-15H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | CFROOZARMPHJFP-KRWDZBQOSA-O |
| XLogP | 1.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|