C20H26NO4+ — CID 3377044
7-(2-hydroxy-3-piperidin-1-ium-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 3377044) has the molecular formula C20H26NO4+ and a molecular weight of 344.43 g/mol. Its IUPAC name is 7-(2-hydroxy-3-piperidin-1-ium-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 7-(2-hydroxy-3-piperidin-1-ium-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 3377044 |
| Molecular Formula | C20H26NO4+ |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 7-(2-hydroxy-3-piperidin-1-ium-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | O=c1oc2cc(OCC(O)C[NH+]3CCCCC3)ccc2c2c1CCC2 |
| InChI | InChI=1S/C20H25NO4/c22-14(12-21-9-2-1-3-10-21)13-24-15-7-8-17-16-5-4-6-18(16)20(23)25-19(17)11-15/h7-8,11,14,22H,1-6,9-10,12-13H2/p+1 |
| InChIKey | IAXURSNRWZLTJH-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|