C22H33N3O7 — CID 2913713
(3,5-dimethoxyphenyl)-[4-(4-ethylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid (PubChem CID 2913713) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[4-(4-ethylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid.
| Compound Name | (3,5-dimethoxyphenyl)-[4-(4-ethylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 2913713 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[4-(4-ethylpiperazin-1-yl)piperidin-1-yl]methanone;oxalic acid |
| SMILES | CCN1CCN(C2CCN(C(=O)c3cc(OC)cc(OC)c3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H31N3O3.C2H2O4/c1-4-21-9-11-22(12-10-21)17-5-7-23(8-6-17)20(24)16-13-18(25-2)15-19(14-16)26-3;3-1(4)2(5)6/h13-15,17H,4-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | KATCWNPUGUXYKL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|