C22H25BrN2O7 — CID 163327888
[4-(4-bromoanilino)piperidin-1-yl]-(3,5-dimethoxyphenyl)methanone;oxalic acid (PubChem CID 163327888) has the molecular formula C22H25BrN2O7 and a molecular weight of 509.35 g/mol. Its IUPAC name is [4-(4-bromoanilino)piperidin-1-yl]-(3,5-dimethoxyphenyl)methanone;oxalic acid.
| Compound Name | [4-(4-bromoanilino)piperidin-1-yl]-(3,5-dimethoxyphenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 163327888 |
| Molecular Formula | C22H25BrN2O7 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | [4-(4-bromoanilino)piperidin-1-yl]-(3,5-dimethoxyphenyl)methanone;oxalic acid |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(Nc3ccc(Br)cc3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23BrN2O3.C2H2O4/c1-25-18-11-14(12-19(13-18)26-2)20(24)23-9-7-17(8-10-23)22-16-5-3-15(21)4-6-16;3-1(4)2(5)6/h3-6,11-13,17,22H,7-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | POCUUSRPYVXYPU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|