C24H18F3N5O3 — CID 29139115
4-ethyl-5-(4-methoxyphenyl)-11-[3-(trifluoromethoxy)phenyl]-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 29139115) has the molecular formula C24H18F3N5O3 and a molecular weight of 481.43 g/mol. Its IUPAC name is 4-ethyl-5-(4-methoxyphenyl)-11-[3-(trifluoromethoxy)phenyl]-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-ethyl-5-(4-methoxyphenyl)-11-[3-(trifluoromethoxy)phenyl]-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 29139115 |
| Molecular Formula | C24H18F3N5O3 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-ethyl-5-(4-methoxyphenyl)-11-[3-(trifluoromethoxy)phenyl]-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCc1nn2c(nnc3c(=O)n(-c4cccc(OC(F)(F)F)c4)ccc32)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H18F3N5O3/c1-3-18-20(14-7-9-16(34-2)10-8-14)22-29-28-21-19(32(22)30-18)11-12-31(23(21)33)15-5-4-6-17(13-15)35-24(25,26)27/h4-13H,3H2,1-2H3 |
| InChIKey | MJWKBFYJCQIQTH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |