C14H10N6O2 — CID 56737861
11-(3-methoxyphenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 56737861) has the molecular formula C14H10N6O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 11-(3-methoxyphenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(3-methoxyphenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 56737861 |
| Molecular Formula | C14H10N6O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 11-(3-methoxyphenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1cccc(-n2ccc3c(nnc4ncnn43)c2=O)c1 |
| InChI | InChI=1S/C14H10N6O2/c1-22-10-4-2-3-9(7-10)19-6-5-11-12(13(19)21)17-18-14-15-8-16-20(11)14/h2-8H,1H3 |
| InChIKey | LMHNRJKNTSGSGX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |