C23H21N3O4 — CID 29146895
[4-[(3S)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl] acetate (PubChem CID 29146895) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is [4-[(3S)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[(3S)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 29146895 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [4-[(3S)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C[C@H](N3CCc4[nH]c5ccccc5c4C3)C2=O)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-14(27)30-16-8-6-15(7-9-16)26-22(28)12-21(23(26)29)25-11-10-20-18(13-25)17-4-2-3-5-19(17)24-20/h2-9,21,24H,10-13H2,1H3/t21-/m0/s1 |
| InChIKey | TVAWJIIBDOZLEA-NRFANRHFSA-N |
| XLogP | 2.78 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|