C20H26N4OS — CID 29153043
N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-5-[(2S)-pyrrolidin-2-yl]thiophene-2-carboxamide (PubChem CID 29153043) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-5-[(2S)-pyrrolidin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-5-[(2S)-pyrrolidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 29153043 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-5-[(2S)-pyrrolidin-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccn2)CC1)c1ccc([C@@H]2CCCN2)s1 |
| InChI | InChI=1S/C20H26N4OS/c25-20(19-7-6-18(26-19)17-5-3-11-22-17)23-15-8-12-24(13-9-15)14-16-4-1-2-10-21-16/h1-2,4,6-7,10,15,17,22H,3,5,8-9,11-14H2,(H,23,25)/t17-/m0/s1 |
| InChIKey | BCYQDOPPALCWEJ-KRWDZBQOSA-N |
| XLogP | 2.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |