C27H44N4O3 — CID 29153972
3-[(3S,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-yl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]propan-1-one (PubChem CID 29153972) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is 3-[(3S,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-yl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-[(3S,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-yl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 29153972 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | 3-[(3S,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-yl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CC[C@H]1CN(Cc2ccccc2)CC[C@H]1N1CCCC1)N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C27H44N4O3/c32-19-21-34-20-18-28-14-16-31(17-15-28)27(33)9-8-25-23-29(22-24-6-2-1-3-7-24)13-10-26(25)30-11-4-5-12-30/h1-3,6-7,25-26,32H,4-5,8-23H2/t25-,26+/m0/s1 |
| InChIKey | UQKJFPPAJDUEFM-IZZNHLLZSA-N |
| XLogP | 1.91 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|