C16H21N7 — CID 29154132
3-[4-(4-butyltriazol-1-yl)piperidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 29154132) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-[4-(4-butyltriazol-1-yl)piperidin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(4-butyltriazol-1-yl)piperidin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 29154132 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-[4-(4-butyltriazol-1-yl)piperidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | CCCCc1cn(C2CCN(c3nccnc3C#N)CC2)nn1 |
| InChI | InChI=1S/C16H21N7/c1-2-3-4-13-12-23(21-20-13)14-5-9-22(10-6-14)16-15(11-17)18-7-8-19-16/h7-8,12,14H,2-6,9-10H2,1H3 |
| InChIKey | LIQZISAYHVBCDW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |