C11H7Cl3F3N5OS — CID 29169398
2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 29169398) has the molecular formula C11H7Cl3F3N5OS and a molecular weight of 420.63 g/mol. Its IUPAC name is 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 29169398 |
| Molecular Formula | C11H7Cl3F3N5OS |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1C(F)(F)F |
| InChI | InChI=1S/C11H7Cl3F3N5OS/c12-4-1-6(14)7(2-5(4)13)19-8(23)3-24-10-21-20-9(22(10)18)11(15,16)17/h1-2H,3,18H2,(H,19,23) |
| InChIKey | LMVOMBMQULKBTH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|