C25H28N4O3S2 — CID 2917775
3-(2-ethylhexyl)-5-[[2-(furan-2-ylmethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2917775) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-5-[[2-(furan-2-ylmethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethylhexyl)-5-[[2-(furan-2-ylmethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2917775 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 3-(2-ethylhexyl)-5-[[2-(furan-2-ylmethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCC(CC)CN1C(=O)C(=Cc2c(NCc3ccco3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C25H28N4O3S2/c1-3-5-9-17(4-2)16-29-24(31)20(34-25(29)33)14-19-22(26-15-18-10-8-13-32-18)27-21-11-6-7-12-28(21)23(19)30/h6-8,10-14,17,26H,3-5,9,15-16H2,1-2H3 |
| InChIKey | PCKKHMJYBHOOLL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|