C21H23ClN2O2 — CID 2919775
ethyl 4-[(4,5,7-trimethylquinolin-2-yl)amino]benzoate;hydrochloride (PubChem CID 2919775) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is ethyl 4-[(4,5,7-trimethylquinolin-2-yl)amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(4,5,7-trimethylquinolin-2-yl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 2919775 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 4-[(4,5,7-trimethylquinolin-2-yl)amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(Nc2cc(C)c3c(C)cc(C)cc3n2)cc1.Cl |
| InChI | InChI=1S/C21H22N2O2.ClH/c1-5-25-21(24)16-6-8-17(9-7-16)22-19-12-15(4)20-14(3)10-13(2)11-18(20)23-19;/h6-12H,5H2,1-4H3,(H,22,23);1H |
| InChIKey | GITKZULHWZQCPL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |