C24H22N2O4S — CID 29201446
[2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 29201446) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 29201446 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)COC(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-17-8-10-18(11-9-17)15-25-24(29)20-6-2-3-7-21(20)26-22(27)16-30-23(28)13-12-19-5-4-14-31-19/h2-14H,15-16H2,1H3,(H,25,29)(H,26,27)/b13-12+ |
| InChIKey | SSFYURNESMTKSR-OUKQBFOZSA-N |
| XLogP | 4.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|