C19H24ClN3O3 — CID 29211303
propyl 4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]benzoate (PubChem CID 29211303) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is propyl 4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]benzoate.
| Compound Name | propyl 4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 29211303 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | propyl 4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2c(C)nn(CC(C)C)c2Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-5-10-26-19(25)14-6-8-15(9-7-14)21-18(24)16-13(4)22-23(17(16)20)11-12(2)3/h6-9,12H,5,10-11H2,1-4H3,(H,21,24) |
| InChIKey | ZBWPBQQHKUBQMH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |