C19H27ClN4O — CID 27229200
5-chloro-N-[4-(diethylamino)phenyl]-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide (PubChem CID 27229200) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is 5-chloro-N-[4-(diethylamino)phenyl]-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[4-(diethylamino)phenyl]-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 27229200 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 5-chloro-N-[4-(diethylamino)phenyl]-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2c(C)nn(CC(C)C)c2Cl)cc1 |
| InChI | InChI=1S/C19H27ClN4O/c1-6-23(7-2)16-10-8-15(9-11-16)21-19(25)17-14(5)22-24(18(17)20)12-13(3)4/h8-11,13H,6-7,12H2,1-5H3,(H,21,25) |
| InChIKey | QHHRNGAOMPJOAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|