C16H19Cl2N3O — CID 26087171
5-chloro-N-(3-chloro-4-methylphenyl)-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide (PubChem CID 26087171) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-4-methylphenyl)-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-(3-chloro-4-methylphenyl)-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 26087171 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 5-chloro-N-(3-chloro-4-methylphenyl)-3-methyl-1-(2-methylpropyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)nn(CC(C)C)c2Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O/c1-9(2)8-21-15(18)14(11(4)20-21)16(22)19-12-6-5-10(3)13(17)7-12/h5-7,9H,8H2,1-4H3,(H,19,22) |
| InChIKey | RHKXKTTVYFZYRD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |