C17H23ClN4O3S — CID 9479377
1-butyl-5-chloro-3-methyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide (PubChem CID 9479377) has the molecular formula C17H23ClN4O3S and a molecular weight of 398.92 g/mol. Its IUPAC name is 1-butyl-5-chloro-3-methyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-butyl-5-chloro-3-methyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9479377 |
| Molecular Formula | C17H23ClN4O3S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-butyl-5-chloro-3-methyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide |
| SMILES | CCCCn1nc(C)c(C(=O)Nc2ccc(C)c(S(=O)(=O)NC)c2)c1Cl |
| InChI | InChI=1S/C17H23ClN4O3S/c1-5-6-9-22-16(18)15(12(3)21-22)17(23)20-13-8-7-11(2)14(10-13)26(24,25)19-4/h7-8,10,19H,5-6,9H2,1-4H3,(H,20,23) |
| InChIKey | YLNUSFTYHSKGMT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |