C16H20ClN3O3S — CID 9071947
1-butyl-5-chloro-3-methyl-N-(3-methylsulfonylphenyl)pyrazole-4-carboxamide (PubChem CID 9071947) has the molecular formula C16H20ClN3O3S and a molecular weight of 369.87 g/mol. Its IUPAC name is 1-butyl-5-chloro-3-methyl-N-(3-methylsulfonylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-butyl-5-chloro-3-methyl-N-(3-methylsulfonylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9071947 |
| Molecular Formula | C16H20ClN3O3S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-butyl-5-chloro-3-methyl-N-(3-methylsulfonylphenyl)pyrazole-4-carboxamide |
| SMILES | CCCCn1nc(C)c(C(=O)Nc2cccc(S(C)(=O)=O)c2)c1Cl |
| InChI | InChI=1S/C16H20ClN3O3S/c1-4-5-9-20-15(17)14(11(2)19-20)16(21)18-12-7-6-8-13(10-12)24(3,22)23/h6-8,10H,4-5,9H2,1-3H3,(H,18,21) |
| InChIKey | HZKUTBYOAAHPNS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |