C14H20ClN3O3 — CID 146099643
methyl (E)-4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]but-2-enoate (PubChem CID 146099643) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is methyl (E)-4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 146099643 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl (E)-4-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)c1c(C)nn(CC(C)C)c1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-9(2)8-18-13(15)12(10(3)17-18)14(20)16-7-5-6-11(19)21-4/h5-6,9H,7-8H2,1-4H3,(H,16,20)/b6-5+ |
| InChIKey | BDDZAKVWSNAUHR-AATRIKPKSA-N |
| XLogP | 1.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|