C19H22N4O3 — CID 29214278
3-[1-[1-[(E)-pent-3-enoyl]piperidin-4-yl]triazol-4-yl]benzoic acid (PubChem CID 29214278) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[1-[1-[(E)-pent-3-enoyl]piperidin-4-yl]triazol-4-yl]benzoic acid.
| Compound Name | 3-[1-[1-[(E)-pent-3-enoyl]piperidin-4-yl]triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 29214278 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-[1-[1-[(E)-pent-3-enoyl]piperidin-4-yl]triazol-4-yl]benzoic acid |
| SMILES | C/C=C/CC(=O)N1CCC(n2cc(-c3cccc(C(=O)O)c3)nn2)CC1 |
| InChI | InChI=1S/C19H22N4O3/c1-2-3-7-18(24)22-10-8-16(9-11-22)23-13-17(20-21-23)14-5-4-6-15(12-14)19(25)26/h2-6,12-13,16H,7-11H2,1H3,(H,25,26)/b3-2+ |
| InChIKey | CPXKPDUTJCZWFB-NSCUHMNNSA-N |
| XLogP | 2.77 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|