C23H15ClN2O8 — CID 29219624
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-(4-chloro-2-nitrophenoxy)benzoate (PubChem CID 29219624) has the molecular formula C23H15ClN2O8 and a molecular weight of 482.83 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-(4-chloro-2-nitrophenoxy)benzoate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
|---|---|
| PubChem CID | 29219624 |
| Molecular Formula | C23H15ClN2O8 |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
| SMILES | O=C1COc2ccc(C(=O)COC(=O)c3ccc(Oc4ccc(Cl)cc4[N+](=O)[O-])cc3)cc2N1 |
| InChI | InChI=1S/C23H15ClN2O8/c24-15-4-8-21(18(10-15)26(30)31)34-16-5-1-13(2-6-16)23(29)33-11-19(27)14-3-7-20-17(9-14)25-22(28)12-32-20/h1-10H,11-12H2,(H,25,28) |
| InChIKey | QDUMEYJHZFGRGX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|