C17H21ClN2O2 — CID 2925900
2-[(3-chloro-4-methylanilino)methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 2925900) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylanilino)methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[(3-chloro-4-methylanilino)methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2925900 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[(3-chloro-4-methylanilino)methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(NCN2C(=O)C3CCC(C)CC3C2=O)cc1Cl |
| InChI | InChI=1S/C17H21ClN2O2/c1-10-3-6-13-14(7-10)17(22)20(16(13)21)9-19-12-5-4-11(2)15(18)8-12/h4-5,8,10,13-14,19H,3,6-7,9H2,1-2H3 |
| InChIKey | IOVOCCINDAIIPM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|